C16H20O9 — CID 102257113
methyl 3-[2-(2-methoxy-2-oxoethyl)-4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-3-methyl-5-oxofuran-2-yl]propanoate (PubChem CID 102257113) has the molecular formula C16H20O9 and a molecular weight of 356.33 g/mol. Its IUPAC name is methyl 3-[2-(2-methoxy-2-oxoethyl)-4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-3-methyl-5-oxofuran-2-yl]propanoate.
| Compound Name | methyl 3-[2-(2-methoxy-2-oxoethyl)-4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-3-methyl-5-oxofuran-2-yl]propanoate |
|---|---|
| PubChem CID | 102257113 |
| Molecular Formula | C16H20O9 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | methyl 3-[2-(2-methoxy-2-oxoethyl)-4-[(E)-3-methoxy-3-oxoprop-1-enoxy]-3-methyl-5-oxofuran-2-yl]propanoate |
| SMILES | COC(=O)/C=C/OC1=C(C)C(CCC(=O)OC)(CC(=O)OC)OC1=O |
| InChI | InChI=1S/C16H20O9/c1-10-14(24-8-6-12(18)22-3)15(20)25-16(10,9-13(19)23-4)7-5-11(17)21-2/h6,8H,5,7,9H2,1-4H3/b8-6+ |
| InChIKey | IAEKFJUFFXZTBI-SOFGYWHQSA-N |
| XLogP | 0.78 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|