C10H12O7 — CID 10900853
3-[2-(carboxymethyl)-4-methoxy-5-oxofuran-2-yl]propanoic acid (PubChem CID 10900853) has the molecular formula C10H12O7 and a molecular weight of 244.20 g/mol. Its IUPAC name is 3-[2-(carboxymethyl)-4-methoxy-5-oxofuran-2-yl]propanoic acid.
| Compound Name | 3-[2-(carboxymethyl)-4-methoxy-5-oxofuran-2-yl]propanoic acid |
|---|---|
| PubChem CID | 10900853 |
| Molecular Formula | C10H12O7 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 3-[2-(carboxymethyl)-4-methoxy-5-oxofuran-2-yl]propanoic acid |
| SMILES | COC1=CC(CCC(=O)O)(CC(=O)O)OC1=O |
| InChI | InChI=1S/C10H12O7/c1-16-6-4-10(5-8(13)14,17-9(6)15)3-2-7(11)12/h4H,2-3,5H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | NTVPPSKNXGYIFR-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |