C29H39NO3 — CID 102262638
2,2,4,4-tetramethylpentan-3-yl (2R)-2-(benzhydrylideneamino)-5-oxoheptanoate (PubChem CID 102262638) has the molecular formula C29H39NO3 and a molecular weight of 449.64 g/mol. Its IUPAC name is 2,2,4,4-tetramethylpentan-3-yl (2R)-2-(benzhydrylideneamino)-5-oxoheptanoate.
| Compound Name | 2,2,4,4-tetramethylpentan-3-yl (2R)-2-(benzhydrylideneamino)-5-oxoheptanoate |
|---|---|
| PubChem CID | 102262638 |
| Molecular Formula | C29H39NO3 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | 2,2,4,4-tetramethylpentan-3-yl (2R)-2-(benzhydrylideneamino)-5-oxoheptanoate |
| SMILES | CCC(=O)CC[C@@H](N=C(c1ccccc1)c1ccccc1)C(=O)OC(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C29H39NO3/c1-8-23(31)19-20-24(26(32)33-27(28(2,3)4)29(5,6)7)30-25(21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9-18,24,27H,8,19-20H2,1-7H3/t24-/m1/s1 |
| InChIKey | SULCVHPLYLMURS-XMMPIXPASA-N |
| XLogP | 6.66 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|