C24H24OSi — CID 102273843
(1R,6R)-6-triphenylsilylcyclohex-3-en-1-ol (PubChem CID 102273843) has the molecular formula C24H24OSi and a molecular weight of 356.54 g/mol. Its IUPAC name is (1R,6R)-6-triphenylsilylcyclohex-3-en-1-ol.
| Compound Name | (1R,6R)-6-triphenylsilylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 102273843 |
| Molecular Formula | C24H24OSi |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (1R,6R)-6-triphenylsilylcyclohex-3-en-1-ol |
| SMILES | O[C@@H]1CC=CC[C@H]1[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24OSi/c25-23-18-10-11-19-24(23)26(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-17,23-25H,18-19H2/t23-,24-/m1/s1 |
| InChIKey | WEXXPGIWEGHYBJ-DNQXCXABSA-N |
| XLogP | 3.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|