C15H22O3 — CID 102274911
(1R,4R,5S,8S,12S)-4,11,11,12-tetramethyl-7,13-dioxatetracyclo[6.3.1.11,4.05,12]tridecan-6-one (PubChem CID 102274911) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R,4R,5S,8S,12S)-4,11,11,12-tetramethyl-7,13-dioxatetracyclo[6.3.1.11,4.05,12]tridecan-6-one.
| Compound Name | (1R,4R,5S,8S,12S)-4,11,11,12-tetramethyl-7,13-dioxatetracyclo[6.3.1.11,4.05,12]tridecan-6-one |
|---|---|
| PubChem CID | 102274911 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1R,4R,5S,8S,12S)-4,11,11,12-tetramethyl-7,13-dioxatetracyclo[6.3.1.11,4.05,12]tridecan-6-one |
| SMILES | CC1(C)CC[C@@H]2OC(=O)[C@H]3[C@]2(C)[C@@]12CC[C@@]3(C)O2 |
| InChI | InChI=1S/C15H22O3/c1-12(2)6-5-9-14(4)10(11(16)17-9)13(3)7-8-15(12,14)18-13/h9-10H,5-8H2,1-4H3/t9-,10+,13+,14+,15+/m0/s1 |
| InChIKey | KCRZLEXBOJWAJO-HFTJKPBSSA-N |
| XLogP | 2.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |