C22H18N2O — CID 102278189
N-(4-methylphenyl)-N'-[2-[(2R,3R)-3-phenyloxiran-2-yl]phenyl]methanediimine (PubChem CID 102278189) has the molecular formula C22H18N2O and a molecular weight of 326.40 g/mol. Its IUPAC name is N-(4-methylphenyl)-N'-[2-[(2R,3R)-3-phenyloxiran-2-yl]phenyl]methanediimine.
| Compound Name | N-(4-methylphenyl)-N'-[2-[(2R,3R)-3-phenyloxiran-2-yl]phenyl]methanediimine |
|---|---|
| PubChem CID | 102278189 |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-(4-methylphenyl)-N'-[2-[(2R,3R)-3-phenyloxiran-2-yl]phenyl]methanediimine |
| SMILES | Cc1ccc(N=C=Nc2ccccc2[C@H]2O[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N2O/c1-16-11-13-18(14-12-16)23-15-24-20-10-6-5-9-19(20)22-21(25-22)17-7-3-2-4-8-17/h2-14,21-22H,1H3/t21-,22-/m1/s1 |
| InChIKey | YHZWIWRVTXORTK-FGZHOGPDSA-N |
| XLogP | 5.94 |
| TPSA | 37.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|