About 11-bromo-N'-[(E)-dec-4-enoyl]undecanehydrazide
11-bromo-N'-[(E)-dec-4-enoyl]undecanehydrazide (PubChem CID 102279254) has the molecular formula C21H39BrN2O2
and a molecular weight of 431.46 g/mol. Its IUPAC name is 11-bromo-N'-[(E)-dec-4-enoyl]undecanehydrazide.
Molecular Properties
| Compound Name | 11-bromo-N'-[(E)-dec-4-enoyl]undecanehydrazide |
| PubChem CID | 102279254 |
| Molecular Formula | C21H39BrN2O2 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 11-bromo-N'-[(E)-dec-4-enoyl]undecanehydrazide |
| SMILES | CCCCC/C=C/CCC(=O)NNC(=O)CCCCCCCCCCBr |
| InChI | InChI=1S/C21H39BrN2O2/c1-2-3-4-5-8-11-14-17-20(25)23-24-21(26)18-15-12-9-6-7-10-13-16-19-22/h8,11H,2-7,9-10,12-19H2,1H3,(H,23,25)(H,24,26)/b11-8+ |
| InChIKey | SOORSMMKYGWVRF-DHZHZOJOSA-N |
| XLogP | 5.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 11-bromo-N'-[(E)-dec-4-enoyl]undecanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-bromo-N'-[(E)-dec-4-enoyl]undecanehydrazide?
The IUPAC name of 11-bromo-N'-[(E)-dec-4-enoyl]undecanehydrazide (CID 102279254) is 11-bromo-N'-[(E)-dec-4-enoyl]undecanehydrazide.
What is the SMILES notation for 11-bromo-N'-[(E)-dec-4-enoyl]undecanehydrazide?
The canonical SMILES for 11-bromo-N'-[(E)-dec-4-enoyl]undecanehydrazide is CCCCC/C=C/CCC(=O)NNC(=O)CCCCCCCCCCBr.
What is the InChIKey of 11-bromo-N'-[(E)-dec-4-enoyl]undecanehydrazide?
The InChIKey is SOORSMMKYGWVRF-DHZHZOJOSA-N. The full InChI is InChI=1S/C21H39BrN2O2/c1-2-3-4-5-8-11-14-17-20(25)23-24-21(26)18-15-12-9-6-7-10-13-16-19-22/h8,11H,2-7,9-10,12-19H2,1H3,(H,23,25)(H,24,26)/b11-8+.
What are the key properties of 11-bromo-N'-[(E)-dec-4-enoyl]undecanehydrazide?
11-bromo-N'-[(E)-dec-4-enoyl]undecanehydrazide has a molecular weight of 431.46 g/mol, XLogP of 5.96, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-bromo-N'-[(E)-dec-4-enoyl]undecanehydrazide is sourced from PubChem (CID 102279254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).