C21H40N2O — CID 173235282
N'-prop-1-enyloctadec-9-enehydrazide (PubChem CID 173235282) has the molecular formula C21H40N2O and a molecular weight of 336.56 g/mol. Its IUPAC name is N'-prop-1-enyloctadec-9-enehydrazide.
| Compound Name | N'-prop-1-enyloctadec-9-enehydrazide |
|---|---|
| PubChem CID | 173235282 |
| Molecular Formula | C21H40N2O |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.31 |
| IUPAC Name | N'-prop-1-enyloctadec-9-enehydrazide |
| SMILES | CC=CNNC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C21H40N2O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(24)23-22-20-4-2/h4,11-12,20,22H,3,5-10,13-19H2,1-2H3,(H,23,24) |
| InChIKey | BJNXCIDDAVLRRE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|