C22H20N2O6 — CID 102279840
(6aS,9R,10R,10aS)-6,6-dimethyl-10-nitro-9-(4-nitrophenyl)-6a,9,10,10a-tetrahydrobenzo[c]chromene-8-carbaldehyde (PubChem CID 102279840) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is (6aS,9R,10R,10aS)-6,6-dimethyl-10-nitro-9-(4-nitrophenyl)-6a,9,10,10a-tetrahydrobenzo[c]chromene-8-carbaldehyde.
| Compound Name | (6aS,9R,10R,10aS)-6,6-dimethyl-10-nitro-9-(4-nitrophenyl)-6a,9,10,10a-tetrahydrobenzo[c]chromene-8-carbaldehyde |
|---|---|
| PubChem CID | 102279840 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (6aS,9R,10R,10aS)-6,6-dimethyl-10-nitro-9-(4-nitrophenyl)-6a,9,10,10a-tetrahydrobenzo[c]chromene-8-carbaldehyde |
| SMILES | CC1(C)Oc2ccccc2[C@H]2[C@@H]([N+](=O)[O-])[C@H](c3ccc([N+](=O)[O-])cc3)C(C=O)=C[C@@H]21 |
| InChI | InChI=1S/C22H20N2O6/c1-22(2)17-11-14(12-25)19(13-7-9-15(10-8-13)23(26)27)21(24(28)29)20(17)16-5-3-4-6-18(16)30-22/h3-12,17,19-21H,1-2H3/t17-,19+,20+,21-/m0/s1 |
| InChIKey | GAMXQFLQEUPLPP-KCLUMXDGSA-N |
| XLogP | 4.03 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|