C11H22NO4+ — CID 10228196
[(2R)-2-carboxy-2-(3-methylbutanoyloxy)ethyl]-trimethylazanium (PubChem CID 10228196) has the molecular formula C11H22NO4+ and a molecular weight of 232.30 g/mol. Its IUPAC name is [(2R)-2-carboxy-2-(3-methylbutanoyloxy)ethyl]-trimethylazanium.
| Compound Name | [(2R)-2-carboxy-2-(3-methylbutanoyloxy)ethyl]-trimethylazanium |
|---|---|
| PubChem CID | 10228196 |
| Molecular Formula | C11H22NO4+ |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | [(2R)-2-carboxy-2-(3-methylbutanoyloxy)ethyl]-trimethylazanium |
| SMILES | CC(C)CC(=O)O[C@H](C[N+](C)(C)C)C(=O)O |
| InChI | InChI=1S/C11H21NO4/c1-8(2)6-10(13)16-9(11(14)15)7-12(3,4)5/h8-9H,6-7H2,1-5H3/p+1/t9-/m1/s1 |
| InChIKey | JOLPRTKFEQWGHQ-SECBINFHSA-O |
| XLogP | 0.74 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|