C19H36N4O10+2 — CID 135547887
(E)-but-2-enedioic acid;[(2R)-2-carboxy-2-(3-methylbutanoyloxy)ethyl]-trimethylazanium;carboxymethyl-(diaminomethylidene)-methylazanium (PubChem CID 135547887) has the molecular formula C19H36N4O10+2 and a molecular weight of 480.52 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;[(2R)-2-carboxy-2-(3-methylbutanoyloxy)ethyl]-trimethylazanium;carboxymethyl-(diaminomethylidene)-methylazanium.
| Compound Name | (E)-but-2-enedioic acid;[(2R)-2-carboxy-2-(3-methylbutanoyloxy)ethyl]-trimethylazanium;carboxymethyl-(diaminomethylidene)-methylazanium |
|---|---|
| PubChem CID | 135547887 |
| Molecular Formula | C19H36N4O10+2 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | (E)-but-2-enedioic acid;[(2R)-2-carboxy-2-(3-methylbutanoyloxy)ethyl]-trimethylazanium;carboxymethyl-(diaminomethylidene)-methylazanium |
| SMILES | CC(C)CC(=O)O[C@H](C[N+](C)(C)C)C(=O)O.C[N+](CC(=O)O)=C(N)N.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C11H21NO4.C4H9N3O2.C4H4O4/c1-8(2)6-10(13)16-9(11(14)15)7-12(3,4)5;1-7(4(5)6)2-3(8)9;5-3(6)1-2-4(7)8/h8-9H,6-7H2,1-5H3;2H2,1H3,(H4,5,6,8,9);1-2H,(H,5,6)(H,7,8)/p+2/b;;2-1+/t9-;;/m1../s1 |
| InChIKey | XULHVQMXZSNAFK-HGNKMPSDSA-P |
| XLogP | -1.57 |
| TPSA | 230.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|