C12H10F2N2O2S — CID 102284034
6,7-difluoro-1-methoxy-3-(1,3-thiazol-2-yl)-2H-indol-3-ol (PubChem CID 102284034) has the molecular formula C12H10F2N2O2S and a molecular weight of 284.29 g/mol. Its IUPAC name is 6,7-difluoro-1-methoxy-3-(1,3-thiazol-2-yl)-2H-indol-3-ol.
| Compound Name | 6,7-difluoro-1-methoxy-3-(1,3-thiazol-2-yl)-2H-indol-3-ol |
|---|---|
| PubChem CID | 102284034 |
| Molecular Formula | C12H10F2N2O2S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 6,7-difluoro-1-methoxy-3-(1,3-thiazol-2-yl)-2H-indol-3-ol |
| SMILES | CON1CC(O)(c2nccs2)c2ccc(F)c(F)c21 |
| InChI | InChI=1S/C12H10F2N2O2S/c1-18-16-6-12(17,11-15-4-5-19-11)7-2-3-8(13)9(14)10(7)16/h2-5,17H,6H2,1H3 |
| InChIKey | HIYSRPQENDDHPG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |