C23H18F4N4O4S — CID 144966228
ethyl 2',3',4',5'-tetrafluoro-6-(methoxycarbonylamino)-1-(1,3-thiazol-2-yl)spiro[6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidine-3,1'-indene]-4-carboxylate (PubChem CID 144966228) has the molecular formula C23H18F4N4O4S and a molecular weight of 522.48 g/mol. Its IUPAC name is ethyl 2',3',4',5'-tetrafluoro-6-(methoxycarbonylamino)-1-(1,3-thiazol-2-yl)spiro[6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidine-3,1'-indene]-4-carboxylate.
| Compound Name | ethyl 2',3',4',5'-tetrafluoro-6-(methoxycarbonylamino)-1-(1,3-thiazol-2-yl)spiro[6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidine-3,1'-indene]-4-carboxylate |
|---|---|
| PubChem CID | 144966228 |
| Molecular Formula | C23H18F4N4O4S |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | ethyl 2',3',4',5'-tetrafluoro-6-(methoxycarbonylamino)-1-(1,3-thiazol-2-yl)spiro[6,7-dihydro-5H-pyrrolo[1,2-c]pyrimidine-3,1'-indene]-4-carboxylate |
| SMILES | CCOC(=O)C1=C2CC(NC(=O)OC)CN2C(c2nccs2)=NC12C(F)=C(F)c1c2ccc(F)c1F |
| InChI | InChI=1S/C23H18F4N4O4S/c1-3-35-21(32)15-13-8-10(29-22(33)34-2)9-31(13)19(20-28-6-7-36-20)30-23(15)11-4-5-12(24)16(25)14(11)17(26)18(23)27/h4-7,10H,3,8-9H2,1-2H3,(H,29,33) |
| InChIKey | PKZISZVMXWMTRB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |