C40H52N2O10 — CID 102284391
tert-butyl 2-[(2R,3S,4R,5R,6R)-6-[[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]oxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate (PubChem CID 102284391) has the molecular formula C40H52N2O10 and a molecular weight of 720.86 g/mol. Its IUPAC name is tert-butyl 2-[(2R,3S,4R,5R,6R)-6-[[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]oxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate.
| Compound Name | tert-butyl 2-[(2R,3S,4R,5R,6R)-6-[[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]oxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 102284391 |
| Molecular Formula | C40H52N2O10 |
| Molecular Weight | 720.86 g/mol |
| Exact Mass | 720.36 |
| IUPAC Name | tert-butyl 2-[(2R,3S,4R,5R,6R)-6-[[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]oxymethyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1O[C@H](CONC(=O)CNC(=O)OC(C)(C)C)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C40H52N2O10/c1-39(2,3)51-34(44)22-31-35(46-24-28-16-10-7-11-17-28)37(48-26-30-20-14-9-15-21-30)36(47-25-29-18-12-8-13-19-29)32(50-31)27-49-42-33(43)23-41-38(45)52-40(4,5)6/h7-21,31-32,35-37H,22-27H2,1-6H3,(H,41,45)(H,42,43)/t31-,32-,35+,36-,37-/m1/s1 |
| InChIKey | LXANUXLVWPTWKM-CIWORRGRSA-N |
| XLogP | 5.81 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.86 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|