C10H14F2O5 — CID 102286206
ethyl 2,2-difluoro-2-[(2R,3S)-3-hydroxy-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate (PubChem CID 102286206) has the molecular formula C10H14F2O5 and a molecular weight of 252.21 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-[(2R,3S)-3-hydroxy-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate.
| Compound Name | ethyl 2,2-difluoro-2-[(2R,3S)-3-hydroxy-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate |
|---|---|
| PubChem CID | 102286206 |
| Molecular Formula | C10H14F2O5 |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | ethyl 2,2-difluoro-2-[(2R,3S)-3-hydroxy-2-(hydroxymethyl)-3,6-dihydro-2H-pyran-6-yl]acetate |
| SMILES | CCOC(=O)C(F)(F)C1C=C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C10H14F2O5/c1-2-16-9(15)10(11,12)8-4-3-6(14)7(5-13)17-8/h3-4,6-8,13-14H,2,5H2,1H3/t6-,7+,8?/m0/s1 |
| InChIKey | IFOSCKONNOEMBQ-KJFJCRTCSA-N |
| XLogP | -0.14 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|