C25H18BrN5O2 — CID 10228767
3-(6-bromo-1-methylindol-3-yl)-4-(6-imidazol-1-yl-1-methylindol-3-yl)pyrrole-2,5-dione (PubChem CID 10228767) has the molecular formula C25H18BrN5O2 and a molecular weight of 500.36 g/mol. Its IUPAC name is 3-(6-bromo-1-methylindol-3-yl)-4-(6-imidazol-1-yl-1-methylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(6-bromo-1-methylindol-3-yl)-4-(6-imidazol-1-yl-1-methylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 10228767 |
| Molecular Formula | C25H18BrN5O2 |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 3-(6-bromo-1-methylindol-3-yl)-4-(6-imidazol-1-yl-1-methylindol-3-yl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3cn(C)c4cc(-n5ccnc5)ccc34)C(=O)NC2=O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C25H18BrN5O2/c1-29-11-18(16-5-3-14(26)9-20(16)29)22-23(25(33)28-24(22)32)19-12-30(2)21-10-15(4-6-17(19)21)31-8-7-27-13-31/h3-13H,1-2H3,(H,28,32,33) |
| InChIKey | DGXDDUAYTVVYJC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|