C48H48N2O6S2 — CID 102288923
(E)-2-cyano-3-[3-[7-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2-benzothiophen-1-yl]prop-2-enoic acid (PubChem CID 102288923) has the molecular formula C48H48N2O6S2 and a molecular weight of 813.05 g/mol. Its IUPAC name is (E)-2-cyano-3-[3-[7-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2-benzothiophen-1-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[3-[7-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2-benzothiophen-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102288923 |
| Molecular Formula | C48H48N2O6S2 |
| Molecular Weight | 813.05 g/mol |
| Exact Mass | 812.30 |
| IUPAC Name | (E)-2-cyano-3-[3-[7-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2-benzothiophen-1-yl]prop-2-enoic acid |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(-c3sc(-c4sc(/C=C(\C#N)C(=O)O)c5ccccc45)c4c3OCCO4)cc2)cc1 |
| InChI | InChI=1S/C48H48N2O6S2/c1-3-5-7-11-27-53-38-23-19-36(20-24-38)50(37-21-25-39(26-22-37)54-28-12-8-6-4-2)35-17-15-33(16-18-35)45-43-44(56-30-29-55-43)47(58-45)46-41-14-10-9-13-40(41)42(57-46)31-34(32-49)48(51)52/h9-10,13-26,31H,3-8,11-12,27-30H2,1-2H3,(H,51,52)/b34-31+ |
| InChIKey | DFHJEUMXSSYSBI-WUVHBKSUSA-N |
| XLogP | 13.45 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.05 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|