C27H36FNO5S — CID 10229082
(4S,7R,8S,9S,13E,16S)-13-fluoro-4,8-dihydroxy-5,5,7,9-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 10229082) has the molecular formula C27H36FNO5S and a molecular weight of 505.65 g/mol. Its IUPAC name is (4S,7R,8S,9S,13E,16S)-13-fluoro-4,8-dihydroxy-5,5,7,9-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,13E,16S)-13-fluoro-4,8-dihydroxy-5,5,7,9-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 10229082 |
| Molecular Formula | C27H36FNO5S |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | (4S,7R,8S,9S,13E,16S)-13-fluoro-4,8-dihydroxy-5,5,7,9-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | Cc1nc2cc([C@@H]3C/C=C(/F)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O3)ccc2s1 |
| InChI | InChI=1S/C27H36FNO5S/c1-15-7-6-8-19(28)10-11-21(18-9-12-22-20(13-18)29-17(3)35-22)34-24(31)14-23(30)27(4,5)26(33)16(2)25(15)32/h9-10,12-13,15-16,21,23,25,30,32H,6-8,11,14H2,1-5H3/b19-10+/t15-,16+,21-,23-,25-/m0/s1 |
| InChIKey | QWKVQHYKAWROPR-SICXRBDGSA-N |
| XLogP | 5.60 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |