About 7-nitrodec-9-en-4-one
7-nitrodec-9-en-4-one (PubChem CID 102291523) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is 7-nitrodec-9-en-4-one.
Molecular Properties
| Compound Name | 7-nitrodec-9-en-4-one |
| PubChem CID | 102291523 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 7-nitrodec-9-en-4-one |
| SMILES | C=CCC(CCC(=O)CCC)[N+](=O)[O-] |
| InChI | InChI=1S/C10H17NO3/c1-3-5-9(11(13)14)7-8-10(12)6-4-2/h3,9H,1,4-8H2,2H3 |
| InChIKey | KCHMOXYDQXKXBF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitrodec-9-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitrodec-9-en-4-one?
The IUPAC name of 7-nitrodec-9-en-4-one (CID 102291523) is 7-nitrodec-9-en-4-one.
What is the SMILES notation for 7-nitrodec-9-en-4-one?
The canonical SMILES for 7-nitrodec-9-en-4-one is C=CCC(CCC(=O)CCC)[N+](=O)[O-].
What is the InChIKey of 7-nitrodec-9-en-4-one?
The InChIKey is KCHMOXYDQXKXBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-3-5-9(11(13)14)7-8-10(12)6-4-2/h3,9H,1,4-8H2,2H3.
What are the key properties of 7-nitrodec-9-en-4-one?
7-nitrodec-9-en-4-one has a molecular weight of 199.25 g/mol, XLogP of 2.36, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitrodec-9-en-4-one is sourced from PubChem (CID 102291523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).