C24H23NO4 — CID 102295273
methyl (2S)-1-(2-phenylmethoxynaphthalene-1-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 102295273) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is methyl (2S)-1-(2-phenylmethoxynaphthalene-1-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-(2-phenylmethoxynaphthalene-1-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102295273 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | methyl (2S)-1-(2-phenylmethoxynaphthalene-1-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)c1c(OCc2ccccc2)ccc2ccccc12 |
| InChI | InChI=1S/C24H23NO4/c1-28-24(27)20-12-7-15-25(20)23(26)22-19-11-6-5-10-18(19)13-14-21(22)29-16-17-8-3-2-4-9-17/h2-6,8-11,13-14,20H,7,12,15-16H2,1H3/t20-/m0/s1 |
| InChIKey | CFWKYLRLADTPMJ-FQEVSTJZSA-N |
| XLogP | 4.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |