C25H44NO8PSi — CID 102299369
methyl (2S,3S)-4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]-3-methyl-2-(phenylmethoxycarbonylamino)-4-trimethylsilyloxybutanoate (PubChem CID 102299369) has the molecular formula C25H44NO8PSi and a molecular weight of 545.69 g/mol. Its IUPAC name is methyl (2S,3S)-4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]-3-methyl-2-(phenylmethoxycarbonylamino)-4-trimethylsilyloxybutanoate.
| Compound Name | methyl (2S,3S)-4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]-3-methyl-2-(phenylmethoxycarbonylamino)-4-trimethylsilyloxybutanoate |
|---|---|
| PubChem CID | 102299369 |
| Molecular Formula | C25H44NO8PSi |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | methyl (2S,3S)-4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]-3-methyl-2-(phenylmethoxycarbonylamino)-4-trimethylsilyloxybutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)OCc1ccccc1)[C@H](C)C(O[Si](C)(C)C)P(=O)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C25H44NO8PSi/c1-18(20(21(27)30-8)26-23(28)31-17-19-15-13-12-14-16-19)22(32-36(9,10)11)35(29,33-24(2,3)4)34-25(5,6)7/h12-16,18,20,22H,17H2,1-11H3,(H,26,28)/t18-,20-,22?/m0/s1 |
| InChIKey | VOFQWLWZFLCIFI-LCODYBDSSA-N |
| XLogP | 6.09 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|