C29H42NO8P — CID 129132241
ethyl (2S,3R)-3-benzyl-4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]-4-hydroxy-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 129132241) has the molecular formula C29H42NO8P and a molecular weight of 563.63 g/mol. Its IUPAC name is ethyl (2S,3R)-3-benzyl-4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]-4-hydroxy-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | ethyl (2S,3R)-3-benzyl-4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]-4-hydroxy-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 129132241 |
| Molecular Formula | C29H42NO8P |
| Molecular Weight | 563.63 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | ethyl (2S,3R)-3-benzyl-4-[bis[(2-methylpropan-2-yl)oxy]phosphoryl]-4-hydroxy-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CCOC(=O)[C@@H](NC(=O)OCc1ccccc1)[C@@H](Cc1ccccc1)C(O)P(=O)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C29H42NO8P/c1-8-35-25(31)24(30-27(33)36-20-22-17-13-10-14-18-22)23(19-21-15-11-9-12-16-21)26(32)39(34,37-28(2,3)4)38-29(5,6)7/h9-18,23-24,26,32H,8,19-20H2,1-7H3,(H,30,33)/t23-,24+,26?/m1/s1 |
| InChIKey | SSMWDNDNWRTWHE-QDQVWJFBSA-N |
| XLogP | 5.85 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|