C29H28N4O2S — CID 102301179
methyl 1-[2-(cyclohexen-1-yl)ethyl]-2-[3-(thiophen-2-ylmethyl)benzimidazol-4-yl]benzimidazole-5-carboxylate (PubChem CID 102301179) has the molecular formula C29H28N4O2S and a molecular weight of 496.64 g/mol. Its IUPAC name is methyl 1-[2-(cyclohexen-1-yl)ethyl]-2-[3-(thiophen-2-ylmethyl)benzimidazol-4-yl]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-[2-(cyclohexen-1-yl)ethyl]-2-[3-(thiophen-2-ylmethyl)benzimidazol-4-yl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 102301179 |
| Molecular Formula | C29H28N4O2S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | methyl 1-[2-(cyclohexen-1-yl)ethyl]-2-[3-(thiophen-2-ylmethyl)benzimidazol-4-yl]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(-c1cccc3ncn(Cc4cccs4)c13)n2CCC1=CCCCC1 |
| InChI | InChI=1S/C29H28N4O2S/c1-35-29(34)21-12-13-26-25(17-21)31-28(33(26)15-14-20-7-3-2-4-8-20)23-10-5-11-24-27(23)32(19-30-24)18-22-9-6-16-36-22/h5-7,9-13,16-17,19H,2-4,8,14-15,18H2,1H3 |
| InChIKey | KKKYBCGCQCGBLD-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|