C29H39N5O2 — CID 58217272
methyl 1-butyl-2-[2-(butylamino)-3-(3-methylbutyl)benzimidazol-4-yl]benzimidazole-5-carboxylate (PubChem CID 58217272) has the molecular formula C29H39N5O2 and a molecular weight of 489.66 g/mol. Its IUPAC name is methyl 1-butyl-2-[2-(butylamino)-3-(3-methylbutyl)benzimidazol-4-yl]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-butyl-2-[2-(butylamino)-3-(3-methylbutyl)benzimidazol-4-yl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 58217272 |
| Molecular Formula | C29H39N5O2 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | methyl 1-butyl-2-[2-(butylamino)-3-(3-methylbutyl)benzimidazol-4-yl]benzimidazole-5-carboxylate |
| SMILES | CCCCNc1nc2cccc(-c3nc4cc(C(=O)OC)ccc4n3CCCC)c2n1CCC(C)C |
| InChI | InChI=1S/C29H39N5O2/c1-6-8-16-30-29-32-23-12-10-11-22(26(23)34(29)18-15-20(3)4)27-31-24-19-21(28(35)36-5)13-14-25(24)33(27)17-9-7-2/h10-14,19-20H,6-9,15-18H2,1-5H3,(H,30,32) |
| InChIKey | FUKRPUUCHOSABR-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|