C35H34N4O2S — CID 58217200
methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-(3,3-diphenylpropyl)benzimidazole-5-carboxylate (PubChem CID 58217200) has the molecular formula C35H34N4O2S and a molecular weight of 574.75 g/mol. Its IUPAC name is methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-(3,3-diphenylpropyl)benzimidazole-5-carboxylate.
| Compound Name | methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-(3,3-diphenylpropyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 58217200 |
| Molecular Formula | C35H34N4O2S |
| Molecular Weight | 574.75 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-(3,3-diphenylpropyl)benzimidazole-5-carboxylate |
| SMILES | CCCCNc1nc2cccc(-c3nc4cc(C(=O)OC)ccc4n3CCC(c3ccccc3)c3ccccc3)c2s1 |
| InChI | InChI=1S/C35H34N4O2S/c1-3-4-21-36-35-38-29-17-11-16-28(32(29)42-35)33-37-30-23-26(34(40)41-2)18-19-31(30)39(33)22-20-27(24-12-7-5-8-13-24)25-14-9-6-10-15-25/h5-19,23,27H,3-4,20-22H2,1-2H3,(H,36,38) |
| InChIKey | SIHSVXYKIBBWCN-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.75 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|