C30H26ClN3O2 — CID 71601280
methyl 2-(3-amino-2-chlorophenyl)-1-(3,3-diphenylpropyl)benzimidazole-5-carboxylate (PubChem CID 71601280) has the molecular formula C30H26ClN3O2 and a molecular weight of 496.01 g/mol. Its IUPAC name is methyl 2-(3-amino-2-chlorophenyl)-1-(3,3-diphenylpropyl)benzimidazole-5-carboxylate.
| Compound Name | methyl 2-(3-amino-2-chlorophenyl)-1-(3,3-diphenylpropyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 71601280 |
| Molecular Formula | C30H26ClN3O2 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | methyl 2-(3-amino-2-chlorophenyl)-1-(3,3-diphenylpropyl)benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(-c1cccc(N)c1Cl)n2CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H26ClN3O2/c1-36-30(35)22-15-16-27-26(19-22)33-29(24-13-8-14-25(32)28(24)31)34(27)18-17-23(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-16,19,23H,17-18,32H2,1H3 |
| InChIKey | LQHNYCHFJMAYPT-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|