C33H39N5O3 — CID 58217254
methyl 1-(3-methoxypropyl)-2-[3-(3-methylbutyl)-2-(2-phenylethylamino)benzimidazol-4-yl]benzimidazole-5-carboxylate (PubChem CID 58217254) has the molecular formula C33H39N5O3 and a molecular weight of 553.71 g/mol. Its IUPAC name is methyl 1-(3-methoxypropyl)-2-[3-(3-methylbutyl)-2-(2-phenylethylamino)benzimidazol-4-yl]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-(3-methoxypropyl)-2-[3-(3-methylbutyl)-2-(2-phenylethylamino)benzimidazol-4-yl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 58217254 |
| Molecular Formula | C33H39N5O3 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | methyl 1-(3-methoxypropyl)-2-[3-(3-methylbutyl)-2-(2-phenylethylamino)benzimidazol-4-yl]benzimidazole-5-carboxylate |
| SMILES | COCCCn1c(-c2cccc3nc(NCCc4ccccc4)n(CCC(C)C)c23)nc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C33H39N5O3/c1-23(2)17-20-38-30-26(12-8-13-27(30)36-33(38)34-18-16-24-10-6-5-7-11-24)31-35-28-22-25(32(39)41-4)14-15-29(28)37(31)19-9-21-40-3/h5-8,10-15,22-23H,9,16-21H2,1-4H3,(H,34,36) |
| InChIKey | XQEAPYPJUXHOMT-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|