C25H31ClN4O3S — CID 71600787
methyl 2-[2-chloro-3-(3-methoxypropylcarbamothioylamino)phenyl]-1-pentylbenzimidazole-5-carboxylate (PubChem CID 71600787) has the molecular formula C25H31ClN4O3S and a molecular weight of 503.07 g/mol. Its IUPAC name is methyl 2-[2-chloro-3-(3-methoxypropylcarbamothioylamino)phenyl]-1-pentylbenzimidazole-5-carboxylate.
| Compound Name | methyl 2-[2-chloro-3-(3-methoxypropylcarbamothioylamino)phenyl]-1-pentylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 71600787 |
| Molecular Formula | C25H31ClN4O3S |
| Molecular Weight | 503.07 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | methyl 2-[2-chloro-3-(3-methoxypropylcarbamothioylamino)phenyl]-1-pentylbenzimidazole-5-carboxylate |
| SMILES | CCCCCn1c(-c2cccc(NC(=S)NCCCOC)c2Cl)nc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C25H31ClN4O3S/c1-4-5-6-14-30-21-12-11-17(24(31)33-3)16-20(21)28-23(30)18-9-7-10-19(22(18)26)29-25(34)27-13-8-15-32-2/h7,9-12,16H,4-6,8,13-15H2,1-3H3,(H2,27,29,34) |
| InChIKey | ZGSBIEPCCKUQHN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.07 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|