C18H20N4O2 — CID 102441051
methyl 2-(2-amino-3-pyridinyl)-1-butylbenzimidazole-5-carboxylate (PubChem CID 102441051) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is methyl 2-(2-amino-3-pyridinyl)-1-butylbenzimidazole-5-carboxylate.
| Compound Name | methyl 2-(2-amino-3-pyridinyl)-1-butylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 102441051 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | methyl 2-(2-amino-3-pyridinyl)-1-butylbenzimidazole-5-carboxylate |
| SMILES | CCCCn1c(-c2cccnc2N)nc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C18H20N4O2/c1-3-4-10-22-15-8-7-12(18(23)24-2)11-14(15)21-17(22)13-6-5-9-20-16(13)19/h5-9,11H,3-4,10H2,1-2H3,(H2,19,20) |
| InChIKey | CFVKJMAKBMTPCU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |