C28H32N4O3 — CID 58217289
methyl 1-butyl-2-[3-[2-(cyclohexen-1-yl)ethyl]-2-oxo-1H-benzimidazol-4-yl]benzimidazole-5-carboxylate (PubChem CID 58217289) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is methyl 1-butyl-2-[3-[2-(cyclohexen-1-yl)ethyl]-2-oxo-1H-benzimidazol-4-yl]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-butyl-2-[3-[2-(cyclohexen-1-yl)ethyl]-2-oxo-1H-benzimidazol-4-yl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 58217289 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | methyl 1-butyl-2-[3-[2-(cyclohexen-1-yl)ethyl]-2-oxo-1H-benzimidazol-4-yl]benzimidazole-5-carboxylate |
| SMILES | CCCCn1c(-c2cccc3[nH]c(=O)n(CCC4=CCCCC4)c23)nc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C28H32N4O3/c1-3-4-16-31-24-14-13-20(27(33)35-2)18-23(24)29-26(31)21-11-8-12-22-25(21)32(28(34)30-22)17-15-19-9-6-5-7-10-19/h8-9,11-14,18H,3-7,10,15-17H2,1-2H3,(H,30,34) |
| InChIKey | CHRRMONKLBRPEN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|