C33H33N3O6 — CID 58217413
methyl 1-[2-(cyclohexen-1-yl)ethyl]-2-[2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-7-yl]benzimidazole-5-carboxylate (PubChem CID 58217413) has the molecular formula C33H33N3O6 and a molecular weight of 567.64 g/mol. Its IUPAC name is methyl 1-[2-(cyclohexen-1-yl)ethyl]-2-[2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-7-yl]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-[2-(cyclohexen-1-yl)ethyl]-2-[2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-7-yl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 58217413 |
| Molecular Formula | C33H33N3O6 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | methyl 1-[2-(cyclohexen-1-yl)ethyl]-2-[2-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-7-yl]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(-c1cccc3nc(-c4cc(OC)c(OC)c(OC)c4)oc13)n2CCC1=CCCCC1 |
| InChI | InChI=1S/C33H33N3O6/c1-38-27-18-22(19-28(39-2)30(27)40-3)32-35-24-12-8-11-23(29(24)42-32)31-34-25-17-21(33(37)41-4)13-14-26(25)36(31)16-15-20-9-6-5-7-10-20/h8-9,11-14,17-19H,5-7,10,15-16H2,1-4H3 |
| InChIKey | ZBSRKCPIRQYGOV-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 97.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|