C7H16O3P2 — CID 102305196
[(4R,5R)-2-methyl-4,5-bis(phosphanylmethyl)-1,3-dioxolan-2-yl]methanol (PubChem CID 102305196) has the molecular formula C7H16O3P2 and a molecular weight of 210.15 g/mol. Its IUPAC name is [(4R,5R)-2-methyl-4,5-bis(phosphanylmethyl)-1,3-dioxolan-2-yl]methanol.
| Compound Name | [(4R,5R)-2-methyl-4,5-bis(phosphanylmethyl)-1,3-dioxolan-2-yl]methanol |
|---|---|
| PubChem CID | 102305196 |
| Molecular Formula | C7H16O3P2 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | [(4R,5R)-2-methyl-4,5-bis(phosphanylmethyl)-1,3-dioxolan-2-yl]methanol |
| SMILES | CC1(CO)O[C@@H](CP)[C@H](CP)O1 |
| InChI | InChI=1S/C7H16O3P2/c1-7(4-8)9-5(2-11)6(3-12)10-7/h5-6,8H,2-4,11-12H2,1H3/t5-,6-/m0/s1 |
| InChIKey | FOIASLNVFPLNDK-WDSKDSINSA-N |
| XLogP | 0.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|