C26H22O3 — CID 102309823
2-(4-methoxyphenyl)-2-(5-methylfuran-2-yl)-1,2-diphenylethanone (PubChem CID 102309823) has the molecular formula C26H22O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-(5-methylfuran-2-yl)-1,2-diphenylethanone.
| Compound Name | 2-(4-methoxyphenyl)-2-(5-methylfuran-2-yl)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 102309823 |
| Molecular Formula | C26H22O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-(5-methylfuran-2-yl)-1,2-diphenylethanone |
| SMILES | COc1ccc(C(C(=O)c2ccccc2)(c2ccccc2)c2ccc(C)o2)cc1 |
| InChI | InChI=1S/C26H22O3/c1-19-13-18-24(29-19)26(21-11-7-4-8-12-21,22-14-16-23(28-2)17-15-22)25(27)20-9-5-3-6-10-20/h3-18H,1-2H3 |
| InChIKey | NNOGOLPHBMPCAC-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |