C37H34N2O4 — CID 5131377
N-(4-methoxyphenyl)-N'-[2-(4-methoxyphenyl)-2,2-bis(4-methylphenyl)acetyl]benzohydrazide (PubChem CID 5131377) has the molecular formula C37H34N2O4 and a molecular weight of 570.69 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N'-[2-(4-methoxyphenyl)-2,2-bis(4-methylphenyl)acetyl]benzohydrazide.
| Compound Name | N-(4-methoxyphenyl)-N'-[2-(4-methoxyphenyl)-2,2-bis(4-methylphenyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 5131377 |
| Molecular Formula | C37H34N2O4 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | N-(4-methoxyphenyl)-N'-[2-(4-methoxyphenyl)-2,2-bis(4-methylphenyl)acetyl]benzohydrazide |
| SMILES | COc1ccc(N(NC(=O)C(c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(OC)cc2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H34N2O4/c1-26-10-14-29(15-11-26)37(30-16-12-27(2)13-17-30,31-18-22-33(42-3)23-19-31)36(41)38-39(32-20-24-34(43-4)25-21-32)35(40)28-8-6-5-7-9-28/h5-25H,1-4H3,(H,38,41) |
| InChIKey | OGRZDHKVXCVKSZ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|