C42H43NO7 — CID 102309988
methyl 3-[[(2R,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]amino]benzoate (PubChem CID 102309988) has the molecular formula C42H43NO7 and a molecular weight of 673.81 g/mol. Its IUPAC name is methyl 3-[[(2R,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]amino]benzoate.
| Compound Name | methyl 3-[[(2R,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 102309988 |
| Molecular Formula | C42H43NO7 |
| Molecular Weight | 673.81 g/mol |
| Exact Mass | 673.30 |
| IUPAC Name | methyl 3-[[(2R,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(N[C@H]2[C@H](OCc3ccccc3)O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)c1 |
| InChI | InChI=1S/C42H43NO7/c1-45-41(44)35-23-14-24-36(25-35)43-38-40(48-28-33-19-10-4-11-20-33)39(47-27-32-17-8-3-9-18-32)37(30-46-26-31-15-6-2-7-16-31)50-42(38)49-29-34-21-12-5-13-22-34/h2-25,37-40,42-43H,26-30H2,1H3/t37-,38-,39-,40-,42-/m1/s1 |
| InChIKey | NUIUYPWWZSXOMO-HNYMXLHISA-N |
| XLogP | 7.58 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.81 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |