C5H8F3NO2S — CID 102316638
N-[(Z)-but-2-enyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 102316638) has the molecular formula C5H8F3NO2S and a molecular weight of 203.19 g/mol. Its IUPAC name is N-[(Z)-but-2-enyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[(Z)-but-2-enyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 102316638 |
| Molecular Formula | C5H8F3NO2S |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | N-[(Z)-but-2-enyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | C/C=C\CNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H8F3NO2S/c1-2-3-4-9-12(10,11)5(6,7)8/h2-3,9H,4H2,1H3/b3-2- |
| InChIKey | PXGHQARCDCWPRI-IHWYPQMZSA-N |
| XLogP | 1.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|