C16H22O5 — CID 102317781
(1R,5S,7R,10R,14R)-7-methyl-3,6,12-trioxatricyclo[12.4.0.05,10]octadec-8-ene-4,13-dione (PubChem CID 102317781) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is (1R,5S,7R,10R,14R)-7-methyl-3,6,12-trioxatricyclo[12.4.0.05,10]octadec-8-ene-4,13-dione.
| Compound Name | (1R,5S,7R,10R,14R)-7-methyl-3,6,12-trioxatricyclo[12.4.0.05,10]octadec-8-ene-4,13-dione |
|---|---|
| PubChem CID | 102317781 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (1R,5S,7R,10R,14R)-7-methyl-3,6,12-trioxatricyclo[12.4.0.05,10]octadec-8-ene-4,13-dione |
| SMILES | C[C@@H]1C=C[C@@H]2COC(=O)[C@@H]3CCCC[C@H]3COC(=O)[C@H]2O1 |
| InChI | InChI=1S/C16H22O5/c1-10-6-7-12-9-19-15(17)13-5-3-2-4-11(13)8-20-16(18)14(12)21-10/h6-7,10-14H,2-5,8-9H2,1H3/t10-,11+,12-,13-,14+/m1/s1 |
| InChIKey | GXPGEOXRPVNJFJ-ITGHMWBKSA-N |
| XLogP | 1.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|