C9H14OS — CID 14870038
1,3a,4,5,6,7,8,8a-octahydrocyclohepta[c]furan-3-thione (PubChem CID 14870038) has the molecular formula C9H14OS and a molecular weight of 170.28 g/mol. Its IUPAC name is 1,3a,4,5,6,7,8,8a-octahydrocyclohepta[c]furan-3-thione.
| Compound Name | 1,3a,4,5,6,7,8,8a-octahydrocyclohepta[c]furan-3-thione |
|---|---|
| PubChem CID | 14870038 |
| Molecular Formula | C9H14OS |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 1,3a,4,5,6,7,8,8a-octahydrocyclohepta[c]furan-3-thione |
| SMILES | S=C1OCC2CCCCCC12 |
| InChI | InChI=1S/C9H14OS/c11-9-8-5-3-1-2-4-7(8)6-10-9/h7-8H,1-6H2 |
| InChIKey | SRTUELTXYOIOAR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|