C5H6OS — CID 102004015
(1S,5R)-3-oxabicyclo[3.1.0]hexane-2-thione (PubChem CID 102004015) has the molecular formula C5H6OS and a molecular weight of 114.17 g/mol. Its IUPAC name is (1S,5R)-3-oxabicyclo[3.1.0]hexane-2-thione.
| Compound Name | (1S,5R)-3-oxabicyclo[3.1.0]hexane-2-thione |
|---|---|
| PubChem CID | 102004015 |
| Molecular Formula | C5H6OS |
| Molecular Weight | 114.17 g/mol |
| Exact Mass | 114.01 |
| IUPAC Name | (1S,5R)-3-oxabicyclo[3.1.0]hexane-2-thione |
| SMILES | S=C1OC[C@@H]2C[C@H]12 |
| InChI | InChI=1S/C5H6OS/c7-5-4-1-3(4)2-6-5/h3-4H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | YDTXWIRPZIMPAF-IMJSIDKUSA-N |
| XLogP | 0.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.17 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|