C19H20N2O4 — CID 102318527
(3aS,4R,7aS)-4-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 102318527) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (3aS,4R,7aS)-4-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4R,7aS)-4-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 102318527 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (3aS,4R,7aS)-4-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-2-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CN1C(=O)[C@H]2[C@H](CC=C[C@H]2N2C(=O)OC[C@H]2Cc2ccccc2)C1=O |
| InChI | InChI=1S/C19H20N2O4/c1-20-17(22)14-8-5-9-15(16(14)18(20)23)21-13(11-25-19(21)24)10-12-6-3-2-4-7-12/h2-7,9,13-16H,8,10-11H2,1H3/t13-,14+,15-,16+/m1/s1 |
| InChIKey | RGONZQOEYBULRV-QXSJWSMHSA-N |
| XLogP | 1.61 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|