C28H31N2O5PS — CID 102322025
N-[(1R)-1-[[(S)-anilino(furan-2-yl)methyl]-ethoxyphosphoryl]-2-phenylethyl]-4-methylbenzenesulfonamide (PubChem CID 102322025) has the molecular formula C28H31N2O5PS and a molecular weight of 538.61 g/mol. Its IUPAC name is N-[(1R)-1-[[(S)-anilino(furan-2-yl)methyl]-ethoxyphosphoryl]-2-phenylethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R)-1-[[(S)-anilino(furan-2-yl)methyl]-ethoxyphosphoryl]-2-phenylethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102322025 |
| Molecular Formula | C28H31N2O5PS |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | N-[(1R)-1-[[(S)-anilino(furan-2-yl)methyl]-ethoxyphosphoryl]-2-phenylethyl]-4-methylbenzenesulfonamide |
| SMILES | CCOP(=O)([C@H](Cc1ccccc1)NS(=O)(=O)c1ccc(C)cc1)[C@H](Nc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C28H31N2O5PS/c1-3-35-36(31,28(26-15-10-20-34-26)29-24-13-8-5-9-14-24)27(21-23-11-6-4-7-12-23)30-37(32,33)25-18-16-22(2)17-19-25/h4-20,27-30H,3,21H2,1-2H3/t27-,28+,36?/m1/s1 |
| InChIKey | NLNMZRLFOTWLPZ-XCJVOOQFSA-N |
| XLogP | 6.56 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|