C13H11N3O2 — CID 102322059
1-[(5-phenyl-1,2,4-triazin-3-yl)oxy]but-3-yn-2-ol (PubChem CID 102322059) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 1-[(5-phenyl-1,2,4-triazin-3-yl)oxy]but-3-yn-2-ol.
| Compound Name | 1-[(5-phenyl-1,2,4-triazin-3-yl)oxy]but-3-yn-2-ol |
|---|---|
| PubChem CID | 102322059 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-[(5-phenyl-1,2,4-triazin-3-yl)oxy]but-3-yn-2-ol |
| SMILES | C#CC(O)COc1nncc(-c2ccccc2)n1 |
| InChI | InChI=1S/C13H11N3O2/c1-2-11(17)9-18-13-15-12(8-14-16-13)10-6-4-3-5-7-10/h1,3-8,11,17H,9H2 |
| InChIKey | MUUAFGCROCPFHI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|