C14H16N4O2S — CID 11088027
5-phenyl-3-(pyrrolidin-1-ylsulfonylmethyl)-1,2,4-triazine (PubChem CID 11088027) has the molecular formula C14H16N4O2S and a molecular weight of 304.37 g/mol. Its IUPAC name is 5-phenyl-3-(pyrrolidin-1-ylsulfonylmethyl)-1,2,4-triazine.
| Compound Name | 5-phenyl-3-(pyrrolidin-1-ylsulfonylmethyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 11088027 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 5-phenyl-3-(pyrrolidin-1-ylsulfonylmethyl)-1,2,4-triazine |
| SMILES | O=S(=O)(Cc1nncc(-c2ccccc2)n1)N1CCCC1 |
| InChI | InChI=1S/C14H16N4O2S/c19-21(20,18-8-4-5-9-18)11-14-16-13(10-15-17-14)12-6-2-1-3-7-12/h1-3,6-7,10H,4-5,8-9,11H2 |
| InChIKey | LYWXJVRZRJDYOE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |