C18H34O2Si — CID 102322360
[(1R,2R,3aR,4S,7aS)-4-(methoxymethyl)-2-methyl-2,3,3a,4,7,7a-hexahydro-1H-inden-1-yl]oxy-triethylsilane (PubChem CID 102322360) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is [(1R,2R,3aR,4S,7aS)-4-(methoxymethyl)-2-methyl-2,3,3a,4,7,7a-hexahydro-1H-inden-1-yl]oxy-triethylsilane.
| Compound Name | [(1R,2R,3aR,4S,7aS)-4-(methoxymethyl)-2-methyl-2,3,3a,4,7,7a-hexahydro-1H-inden-1-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 102322360 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | [(1R,2R,3aR,4S,7aS)-4-(methoxymethyl)-2-methyl-2,3,3a,4,7,7a-hexahydro-1H-inden-1-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@H]2CC=C[C@H](COC)[C@H]2C[C@H]1C |
| InChI | InChI=1S/C18H34O2Si/c1-6-21(7-2,8-3)20-18-14(4)12-17-15(13-19-5)10-9-11-16(17)18/h9-10,14-18H,6-8,11-13H2,1-5H3/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | CEBGNDBMPCKWNE-UYTYNIKBSA-N |
| XLogP | 4.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|