C45H64O6SSi — CID 102333159
(E,4S,5E,7R)-1-(benzenesulfonyl)-2,2-dimethyl-4-[(1R)-1-phenylethoxy]-5-(2-phenylmethoxyethylidene)-7-tri(propan-2-yl)silyloxyundec-9-en-3-one (PubChem CID 102333159) has the molecular formula C45H64O6SSi and a molecular weight of 761.15 g/mol. Its IUPAC name is (E,4S,5E,7R)-1-(benzenesulfonyl)-2,2-dimethyl-4-[(1R)-1-phenylethoxy]-5-(2-phenylmethoxyethylidene)-7-tri(propan-2-yl)silyloxyundec-9-en-3-one.
| Compound Name | (E,4S,5E,7R)-1-(benzenesulfonyl)-2,2-dimethyl-4-[(1R)-1-phenylethoxy]-5-(2-phenylmethoxyethylidene)-7-tri(propan-2-yl)silyloxyundec-9-en-3-one |
|---|---|
| PubChem CID | 102333159 |
| Molecular Formula | C45H64O6SSi |
| Molecular Weight | 761.15 g/mol |
| Exact Mass | 760.42 |
| IUPAC Name | (E,4S,5E,7R)-1-(benzenesulfonyl)-2,2-dimethyl-4-[(1R)-1-phenylethoxy]-5-(2-phenylmethoxyethylidene)-7-tri(propan-2-yl)silyloxyundec-9-en-3-one |
| SMILES | C/C=C/C[C@H](C/C(=C\COCc1ccccc1)[C@H](O[C@H](C)c1ccccc1)C(=O)C(C)(C)CS(=O)(=O)c1ccccc1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C45H64O6SSi/c1-11-12-26-41(51-53(34(2)3,35(4)5)36(6)7)31-40(29-30-49-32-38-22-16-13-17-23-38)43(50-37(8)39-24-18-14-19-25-39)44(46)45(9,10)33-52(47,48)42-27-20-15-21-28-42/h11-25,27-29,34-37,41,43H,26,30-33H2,1-10H3/b12-11+,40-29+/t37-,41-,43+/m1/s1 |
| InChIKey | CDHZSGJHGTYFRC-KYMWQUCKSA-N |
| XLogP | 11.26 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.15 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|