C42H52O5SSi — CID 11767665
(E,3S,8S)-4-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-3,7,8-trimethyl-10-phenylmethoxydec-6-en-5-one (PubChem CID 11767665) has the molecular formula C42H52O5SSi and a molecular weight of 697.03 g/mol. Its IUPAC name is (E,3S,8S)-4-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-3,7,8-trimethyl-10-phenylmethoxydec-6-en-5-one.
| Compound Name | (E,3S,8S)-4-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-3,7,8-trimethyl-10-phenylmethoxydec-6-en-5-one |
|---|---|
| PubChem CID | 11767665 |
| Molecular Formula | C42H52O5SSi |
| Molecular Weight | 697.03 g/mol |
| Exact Mass | 696.33 |
| IUPAC Name | (E,3S,8S)-4-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-3,7,8-trimethyl-10-phenylmethoxydec-6-en-5-one |
| SMILES | C/C(=C\C(=O)C([C@@H](C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)S(=O)(=O)c1ccccc1)[C@@H](C)CCOCc1ccccc1 |
| InChI | InChI=1S/C42H52O5SSi/c1-33(27-29-46-32-36-19-11-7-12-20-36)35(3)31-40(43)41(48(44,45)37-21-13-8-14-22-37)34(2)28-30-47-49(42(4,5)6,38-23-15-9-16-24-38)39-25-17-10-18-26-39/h7-26,31,33-34,41H,27-30,32H2,1-6H3/b35-31+/t33-,34-,41?/m0/s1 |
| InChIKey | DYHSVRXRRHHUIH-XDVKCCGASA-N |
| XLogP | 8.19 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.03 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|