C38H48O4SSi — CID 11456373
[(4R,5R)-5-(benzenesulfonylmethyl)-6-methyl-4-phenylmethoxyheptoxy]-tert-butyl-diphenylsilane (PubChem CID 11456373) has the molecular formula C38H48O4SSi and a molecular weight of 628.95 g/mol. Its IUPAC name is [(4R,5R)-5-(benzenesulfonylmethyl)-6-methyl-4-phenylmethoxyheptoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(4R,5R)-5-(benzenesulfonylmethyl)-6-methyl-4-phenylmethoxyheptoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11456373 |
| Molecular Formula | C38H48O4SSi |
| Molecular Weight | 628.95 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | [(4R,5R)-5-(benzenesulfonylmethyl)-6-methyl-4-phenylmethoxyheptoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(C)[C@@H](CS(=O)(=O)c1ccccc1)[C@@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C38H48O4SSi/c1-31(2)36(30-43(39,40)33-21-12-7-13-22-33)37(41-29-32-19-10-6-11-20-32)27-18-28-42-44(38(3,4)5,34-23-14-8-15-24-34)35-25-16-9-17-26-35/h6-17,19-26,31,36-37H,18,27-30H2,1-5H3/t36-,37-/m1/s1 |
| InChIKey | QVRNRGVNZQMZHB-FZNHDDJXSA-N |
| XLogP | 7.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.95 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|