C37H44O5SSi — CID 11135926
[(2S,5S)-5-[(1S)-3-(benzenesulfonyl)-1-phenylmethoxypropyl]oxolan-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 11135926) has the molecular formula C37H44O5SSi and a molecular weight of 628.91 g/mol. Its IUPAC name is [(2S,5S)-5-[(1S)-3-(benzenesulfonyl)-1-phenylmethoxypropyl]oxolan-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2S,5S)-5-[(1S)-3-(benzenesulfonyl)-1-phenylmethoxypropyl]oxolan-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11135926 |
| Molecular Formula | C37H44O5SSi |
| Molecular Weight | 628.91 g/mol |
| Exact Mass | 628.27 |
| IUPAC Name | [(2S,5S)-5-[(1S)-3-(benzenesulfonyl)-1-phenylmethoxypropyl]oxolan-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@@H]([C@H](CCS(=O)(=O)c2ccccc2)OCc2ccccc2)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H44O5SSi/c1-37(2,3)44(33-20-12-6-13-21-33,34-22-14-7-15-23-34)41-29-31-24-25-36(42-31)35(40-28-30-16-8-4-9-17-30)26-27-43(38,39)32-18-10-5-11-19-32/h4-23,31,35-36H,24-29H2,1-3H3/t31-,35-,36-/m0/s1 |
| InChIKey | BCSFXQMMHDVWQT-AENKNVQRSA-N |
| XLogP | 6.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.91 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|