C42H52N2O6S — CID 10233860
(2S)-2-[[3-(1-benzofuran-2-yl)phenyl]methyl-(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-3-phenylpropanoate;tetraethylazanium (PubChem CID 10233860) has the molecular formula C42H52N2O6S and a molecular weight of 712.95 g/mol. Its IUPAC name is (2S)-2-[[3-(1-benzofuran-2-yl)phenyl]methyl-(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-3-phenylpropanoate;tetraethylazanium.
| Compound Name | (2S)-2-[[3-(1-benzofuran-2-yl)phenyl]methyl-(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-3-phenylpropanoate;tetraethylazanium |
|---|---|
| PubChem CID | 10233860 |
| Molecular Formula | C42H52N2O6S |
| Molecular Weight | 712.95 g/mol |
| Exact Mass | 712.35 |
| IUPAC Name | (2S)-2-[[3-(1-benzofuran-2-yl)phenyl]methyl-(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-3-phenylpropanoate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.COc1cc(C)c(S(=O)(=O)N(Cc2cccc(-c3cc4ccccc4o3)c2)[C@@H](Cc2ccccc2)C(=O)[O-])c(C)c1C |
| InChI | InChI=1S/C34H33NO6S.C8H20N/c1-22-17-31(40-4)23(2)24(3)33(22)42(38,39)35(29(34(36)37)19-25-11-6-5-7-12-25)21-26-13-10-15-27(18-26)32-20-28-14-8-9-16-30(28)41-32;1-5-9(6-2,7-3)8-4/h5-18,20,29H,19,21H2,1-4H3,(H,36,37);5-8H2,1-4H3/q;+1/p-1/t29-;/m0./s1 |
| InChIKey | IOXXKDDVQVXYEG-JMAPEOGHSA-M |
| XLogP | 7.47 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.95 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|