C22H19FN2O5 — CID 102340599
ethyl (3S)-3-[(3S)-1-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-1-methyl-2-oxoindole-3-carboxylate (PubChem CID 102340599) has the molecular formula C22H19FN2O5 and a molecular weight of 410.40 g/mol. Its IUPAC name is ethyl (3S)-3-[(3S)-1-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-1-methyl-2-oxoindole-3-carboxylate.
| Compound Name | ethyl (3S)-3-[(3S)-1-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-1-methyl-2-oxoindole-3-carboxylate |
|---|---|
| PubChem CID | 102340599 |
| Molecular Formula | C22H19FN2O5 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | ethyl (3S)-3-[(3S)-1-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-1-methyl-2-oxoindole-3-carboxylate |
| SMILES | CCOC(=O)[C@]1([C@@H]2CC(=O)N(c3cccc(F)c3)C2=O)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C22H19FN2O5/c1-3-30-21(29)22(15-9-4-5-10-17(15)24(2)20(22)28)16-12-18(26)25(19(16)27)14-8-6-7-13(23)11-14/h4-11,16H,3,12H2,1-2H3/t16-,22-/m1/s1 |
| InChIKey | QIFAXHQAERMWMA-OPAMFIHVSA-N |
| XLogP | 2.18 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|